Differenze tra le versioni di "Estazolam"

m
Bot: fix codice DrugBank, vedi discussione
(→‎Effetti sull'EEG nei conigli: wikilink a disambigua)
m (Bot: fix codice DrugBank, vedi discussione)
|suffisso_ATC = CD04
|PubChem = 3261
|DrugBank = DB0121501215
|smiles = <!-- ClC1=CC2=C(C=C1)N3C=NN=C3CN=C2C4=CC=CC=C4-->
|somministrazione = Orale
951 572

contributi