Differenze tra le versioni di "Ibuprofene"

aggiunto costante di dissociazione acida (pKa)
(aggiunto costante di dissociazione acida (pKa))
{{Disclaimer|medico}}
{{Composto chimico
| nome_IUPAC = (''RS'')-acido 2-[4-(2-metilpropil)fenil]propanoico
| immagine1_nome = Ibuprofen2.svg
| immagine1_dimensioni = 280px
| immagine2_nome = Ibuprofen-3D-vdW.png
| immagine2_dimensioni = 200px
| nome_IUPAC = (''RS'')-acido 2-[4-(2-metilpropil)fenil]propanoico
| nomi_alternativi =
| formula = C<sub>13</sub>H<sub>18</sub>O<sub>2</sub>
| massa_molecolare = 206,3
| numero_CAS = 15687-27-1
| prefisso_ATC = M01
| PubChem = 3672
| DrugBank = 01050
| formula = C<sub>13</sub>H<sub>18</sub>O<sub>2</sub>
| massa_molecolare = 206,3
| smiles = CC(C)Cc1ccc(cc1)C(C)C(=O)O
| nomi_alternativi =
| densità_condensato =
| potere_rotatorio_specifico =
| pKa = 4,49
| solubilità_acqua =
| temperatura_di_fusione =
| temperatura_di_ebollizione =
| solubilità_acqua =
| potere_rotatorio_specifico =
| entalpia_standard_combustione =
| biodisponibilità = 49–73%
| protein_bound = 99%
| metabolismo = epatico
| emivita = 2 - 3 ore
| escrezione = renale
|titolo_indicazioni_sicurezza = ---
|simbolo1=irritante
|avvertenza=attenzione
|frasiH={{FrasiH|302}}
|consigliP= ---<ref>Sigma Aldrich; rev. del 21.09.2012</ref>
| entalpia_standard_combustione =
| protein_bound = 99%
|titolo_indicazioni_sicurezza = ---
}}
L<nowiki>'</nowiki>'''ibuprofene''' è un principio attivo che rientra nella famiglia dei [[FANS|farmaci antinfiammatori non steroidei]] ([[FANS]]). Il farmaco è dotato di proprietà [[Analgesico|analgesica]], [[Antinfiammatorio|antinfiammatoria]] e [[Antipiretico|antipiretica]]. Questa classe di farmaci rappresenta la categoria di più largo impiego nel trattamento delle malattie reumatiche.
Utente anonimo