Differenze tra le versioni di "Ibuprofene"

Bot: rimuovo Codice DrugBank ridondante (valore uguale a Wikidata)
m (Bot: rimuovo Codice DrugBank ridondante (valore uguale a Wikidata))
| suffisso_ATC = AE01
| PubChem = 3672
| DrugBank = 01050
| smiles = CC(C)Cc1ccc(cc1)C(C)C(=O)O
| densità_condensato =
651 674
