Utente:Grasso Luigi/sanbox1/ione disolfato
| Disolfato | |
|---|---|
 | |
 | |
| Nome IUPAC | |
| sulfonato sulfate [1] | |
| Caratteristiche generali | |
| Massa molecolare (u) | 176.113 |
| Numero CAS | Immagine_3D_disolfato |
| SMILES | [O-]S(=O)(=O)OS(=O)(=O)[O-] |
| Indicazioni di sicurezza | |
| Simboli di rischio chimico | |
 
| |
| attenzione | |
| Frasi H | --- |
| Consigli P | --- |
In chemistry, disulfate or pyrosulfate is the anion with the molecular formula S2O2−7. Disulfate is the IUPAC name. [2]It has a dichromate-like structure and can be visualised as two corner-sharing SO4 tetrahedra, with a bridging oxygen atom. [3]
Struttura
modificaIn this anion, sulfur has an oxidation state of +6. Disulfate is the conjugate base of the hydrogen disulfate (hydrogen pyrosulfate) ion HS2O−7, which in turn is the conjugate base of disulfuric acid (pyrosulfuric acid).
Voci correlate
modificaNote
modifica- ^ Nomenclature of Inorganic Chemistry : IUPAC Recommendations 2005 (Red Book), Cambridge, The Royal Society of Chemistry, 2005, p. 315, ISBN 978-0-85404-438-2.
- ^ (EN) Nomenclature of Inorganic Chemistry (IUPAC Recommendations 2005). 6ed, Cambridge (UK), RSC/IUPAC (2005). ISBN 0-85404-438-8. Versione elettronica.
- ^ "The crystal structure determinations and refinements of K2S2O7, KNaS2O7 and Na2S2O7 from X-ray powder and single crystal diffraction data", Ståhl K, Balic-Zunic T, da Silva F, Eriksen K M, Berg R W, Fehrmann R Journal of Solid State Chemistry 178, 1697–1704, (2005)DOI: 10.1016/j.jssc.2005.03.022
Altri progetti
modifica
